C14H14N2O4 — CID 11300295
benzyl (4aS,7aR)-3-oxo-2,4a,7,7a-tetrahydrocyclopenta[e][1,3,4]oxadiazine-1-carboxylate (PubChem CID 11300295) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is benzyl (4aS,7aR)-3-oxo-2,4a,7,7a-tetrahydrocyclopenta[e][1,3,4]oxadiazine-1-carboxylate.
| Compound Name | benzyl (4aS,7aR)-3-oxo-2,4a,7,7a-tetrahydrocyclopenta[e][1,3,4]oxadiazine-1-carboxylate |
|---|---|
| PubChem CID | 11300295 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | benzyl (4aS,7aR)-3-oxo-2,4a,7,7a-tetrahydrocyclopenta[e][1,3,4]oxadiazine-1-carboxylate |
| SMILES | O=C1NN(C(=O)OCc2ccccc2)[C@@H]2CC=C[C@@H]2O1 |
| InChI | InChI=1S/C14H14N2O4/c17-13-15-16(11-7-4-8-12(11)20-13)14(18)19-9-10-5-2-1-3-6-10/h1-6,8,11-12H,7,9H2,(H,15,17)/t11-,12+/m1/s1 |
| InChIKey | FJAZSUBRBKMSQQ-NEPJUHHUSA-N |
| XLogP | 1.98 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|