C15H24O5Si — CID 11301425
[(1R,2S,6R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-7-oxabicyclo[4.1.0]hept-3-en-2-yl] acetate (PubChem CID 11301425) has the molecular formula C15H24O5Si and a molecular weight of 312.44 g/mol. Its IUPAC name is [(1R,2S,6R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-7-oxabicyclo[4.1.0]hept-3-en-2-yl] acetate.
| Compound Name | [(1R,2S,6R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-7-oxabicyclo[4.1.0]hept-3-en-2-yl] acetate |
|---|---|
| PubChem CID | 11301425 |
| Molecular Formula | C15H24O5Si |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | [(1R,2S,6R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-7-oxabicyclo[4.1.0]hept-3-en-2-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=C(CO[Si](C)(C)C(C)(C)C)C(=O)[C@@H]2O[C@H]12 |
| InChI | InChI=1S/C15H24O5Si/c1-9(16)19-11-7-10(12(17)14-13(11)20-14)8-18-21(5,6)15(2,3)4/h7,11,13-14H,8H2,1-6H3/t11-,13+,14-/m0/s1 |
| InChIKey | RBZIQLHIFPFWAF-YUTCNCBUSA-N |
| XLogP | 2.22 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|