C27H34BrNOSSi — CID 11307067
[2-[4-[(E)-4-bromobut-2-enyl]-1,3-thiazol-2-yl]-2-methylpropoxy]-tert-butyl-diphenylsilane (PubChem CID 11307067) has the molecular formula C27H34BrNOSSi and a molecular weight of 528.63 g/mol. Its IUPAC name is [2-[4-[(E)-4-bromobut-2-enyl]-1,3-thiazol-2-yl]-2-methylpropoxy]-tert-butyl-diphenylsilane.
| Compound Name | [2-[4-[(E)-4-bromobut-2-enyl]-1,3-thiazol-2-yl]-2-methylpropoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 11307067 |
| Molecular Formula | C27H34BrNOSSi |
| Molecular Weight | 528.63 g/mol |
| Exact Mass | 527.13 |
| IUPAC Name | [2-[4-[(E)-4-bromobut-2-enyl]-1,3-thiazol-2-yl]-2-methylpropoxy]-tert-butyl-diphenylsilane |
| SMILES | CC(C)(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)c1nc(C/C=C/CBr)cs1 |
| InChI | InChI=1S/C27H34BrNOSSi/c1-26(2,3)32(23-15-8-6-9-16-23,24-17-10-7-11-18-24)30-21-27(4,5)25-29-22(20-31-25)14-12-13-19-28/h6-13,15-18,20H,14,19,21H2,1-5H3/b13-12+ |
| InChIKey | RJWLOEDXVYYBHF-OUKQBFOZSA-N |
| XLogP | 6.49 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.63 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|