C25H30N2OSSi — CID 56837237
2-[2-[1-[tert-butyl(diphenyl)silyl]oxy-2-methylpropan-2-yl]-1,3-thiazol-4-yl]acetonitrile (PubChem CID 56837237) has the molecular formula C25H30N2OSSi and a molecular weight of 434.68 g/mol. Its IUPAC name is 2-[2-[1-[tert-butyl(diphenyl)silyl]oxy-2-methylpropan-2-yl]-1,3-thiazol-4-yl]acetonitrile.
| Compound Name | 2-[2-[1-[tert-butyl(diphenyl)silyl]oxy-2-methylpropan-2-yl]-1,3-thiazol-4-yl]acetonitrile |
|---|---|
| PubChem CID | 56837237 |
| Molecular Formula | C25H30N2OSSi |
| Molecular Weight | 434.68 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 2-[2-[1-[tert-butyl(diphenyl)silyl]oxy-2-methylpropan-2-yl]-1,3-thiazol-4-yl]acetonitrile |
| SMILES | CC(C)(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)c1nc(CC#N)cs1 |
| InChI | InChI=1S/C25H30N2OSSi/c1-24(2,3)30(21-12-8-6-9-13-21,22-14-10-7-11-15-22)28-19-25(4,5)23-27-20(16-17-26)18-29-23/h6-15,18H,16,19H2,1-5H3 |
| InChIKey | TUCGKEIFNDJPKL-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.68 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|