C31H38N2O7 — CID 11307380
[(2R)-2-[[(2S)-2-[benzyl(phenylmethoxycarbonyl)amino]pent-4-enoyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]but-3-enyl] acetate (PubChem CID 11307380) has the molecular formula C31H38N2O7 and a molecular weight of 550.65 g/mol. Its IUPAC name is [(2R)-2-[[(2S)-2-[benzyl(phenylmethoxycarbonyl)amino]pent-4-enoyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]but-3-enyl] acetate.
| Compound Name | [(2R)-2-[[(2S)-2-[benzyl(phenylmethoxycarbonyl)amino]pent-4-enoyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]but-3-enyl] acetate |
|---|---|
| PubChem CID | 11307380 |
| Molecular Formula | C31H38N2O7 |
| Molecular Weight | 550.65 g/mol |
| Exact Mass | 550.27 |
| IUPAC Name | [(2R)-2-[[(2S)-2-[benzyl(phenylmethoxycarbonyl)amino]pent-4-enoyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]but-3-enyl] acetate |
| SMILES | C=CC[C@@H](C(=O)N(C(=O)OC(C)(C)C)[C@H](C=C)COC(C)=O)N(Cc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C31H38N2O7/c1-7-15-27(28(35)33(30(37)40-31(4,5)6)26(8-2)22-38-23(3)34)32(20-24-16-11-9-12-17-24)29(36)39-21-25-18-13-10-14-19-25/h7-14,16-19,26-27H,1-2,15,20-22H2,3-6H3/t26-,27+/m1/s1 |
| InChIKey | OTISJDPSDQRARY-SXOMAYOGSA-N |
| XLogP | 5.65 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.65 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|