C42H54O7SSi — CID 11308630
(2R,3R,4S,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethylsulfanyl-4-phenylmethoxyoxolan-3-ol (PubChem CID 11308630) has the molecular formula C42H54O7SSi and a molecular weight of 731.04 g/mol. Its IUPAC name is (2R,3R,4S,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethylsulfanyl-4-phenylmethoxyoxolan-3-ol.
| Compound Name | (2R,3R,4S,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethylsulfanyl-4-phenylmethoxyoxolan-3-ol |
|---|---|
| PubChem CID | 11308630 |
| Molecular Formula | C42H54O7SSi |
| Molecular Weight | 731.04 g/mol |
| Exact Mass | 730.34 |
| IUPAC Name | (2R,3R,4S,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethylsulfanyl-4-phenylmethoxyoxolan-3-ol |
| SMILES | CCS[C@]1(COC(c2ccccc2)(c2ccc(OC)cc2)c2ccc(OC)cc2)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C42H54O7SSi/c1-9-50-41(39(46-28-31-16-12-10-13-17-31)38(43)37(49-41)29-48-51(7,8)40(2,3)4)30-47-42(32-18-14-11-15-19-32,33-20-24-35(44-5)25-21-33)34-22-26-36(45-6)27-23-34/h10-27,37-39,43H,9,28-30H2,1-8H3/t37-,38-,39+,41+/m1/s1 |
| InChIKey | HXUAQEXFEHZOIM-KSSIXINKSA-N |
| XLogP | 8.83 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.04 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|