C19H18N2O4S — CID 113089153
2-(1,3-benzodioxol-5-ylsulfonyl)-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole (PubChem CID 113089153) has the molecular formula C19H18N2O4S and a molecular weight of 370.43 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylsulfonyl)-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole.
| Compound Name | 2-(1,3-benzodioxol-5-ylsulfonyl)-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 113089153 |
| Molecular Formula | C19H18N2O4S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylsulfonyl)-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole |
| SMILES | Cn1c2c(c3ccccc31)CN(S(=O)(=O)c1ccc3c(c1)OCO3)CC2 |
| InChI | InChI=1S/C19H18N2O4S/c1-20-16-5-3-2-4-14(16)15-11-21(9-8-17(15)20)26(22,23)13-6-7-18-19(10-13)25-12-24-18/h2-7,10H,8-9,11-12H2,1H3 |
| InChIKey | VHQCYKDNIKKLJM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|