C16H24O4SSi — CID 11313820
(2S,3R)-3-[2-(benzenesulfonyl)ethyl]-5-trimethylsilylpent-4-yne-1,2-diol (PubChem CID 11313820) has the molecular formula C16H24O4SSi and a molecular weight of 340.52 g/mol. Its IUPAC name is (2S,3R)-3-[2-(benzenesulfonyl)ethyl]-5-trimethylsilylpent-4-yne-1,2-diol.
| Compound Name | (2S,3R)-3-[2-(benzenesulfonyl)ethyl]-5-trimethylsilylpent-4-yne-1,2-diol |
|---|---|
| PubChem CID | 11313820 |
| Molecular Formula | C16H24O4SSi |
| Molecular Weight | 340.52 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | (2S,3R)-3-[2-(benzenesulfonyl)ethyl]-5-trimethylsilylpent-4-yne-1,2-diol |
| SMILES | C[Si](C)(C)C#C[C@@H](CCS(=O)(=O)c1ccccc1)[C@H](O)CO |
| InChI | InChI=1S/C16H24O4SSi/c1-22(2,3)12-10-14(16(18)13-17)9-11-21(19,20)15-7-5-4-6-8-15/h4-8,14,16-18H,9,11,13H2,1-3H3/t14-,16-/m1/s1 |
| InChIKey | WJUCFMVVRBDOHB-GDBMZVCRSA-N |
| XLogP | 1.70 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.52 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|