C13H16BrNO2S — CID 113232378
N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]thian-4-amine (PubChem CID 113232378) has the molecular formula C13H16BrNO2S and a molecular weight of 330.25 g/mol. Its IUPAC name is N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]thian-4-amine.
| Compound Name | N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]thian-4-amine |
|---|---|
| PubChem CID | 113232378 |
| Molecular Formula | C13H16BrNO2S |
| Molecular Weight | 330.25 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]thian-4-amine |
| SMILES | Brc1cc2c(cc1CNC1CCSCC1)OCO2 |
| InChI | InChI=1S/C13H16BrNO2S/c14-11-6-13-12(16-8-17-13)5-9(11)7-15-10-1-3-18-4-2-10/h5-6,10,15H,1-4,7-8H2 |
| InChIKey | JELFDFIDBNSVLV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.25 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |