C19H27ClN2O2 — CID 11325590
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2E)-2-chloro-2-[(4-methylphenyl)hydrazinylidene]acetate (PubChem CID 11325590) has the molecular formula C19H27ClN2O2 and a molecular weight of 350.89 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2E)-2-chloro-2-[(4-methylphenyl)hydrazinylidene]acetate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2E)-2-chloro-2-[(4-methylphenyl)hydrazinylidene]acetate |
|---|---|
| PubChem CID | 11325590 |
| Molecular Formula | C19H27ClN2O2 |
| Molecular Weight | 350.89 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2E)-2-chloro-2-[(4-methylphenyl)hydrazinylidene]acetate |
| SMILES | Cc1ccc(N/N=C(/Cl)C(=O)O[C@@H]2C[C@H](C)CC[C@H]2C(C)C)cc1 |
| InChI | InChI=1S/C19H27ClN2O2/c1-12(2)16-10-7-14(4)11-17(16)24-19(23)18(20)22-21-15-8-5-13(3)6-9-15/h5-6,8-9,12,14,16-17,21H,7,10-11H2,1-4H3/b22-18+/t14-,16+,17-/m1/s1 |
| InChIKey | SZTLWZQASDXFQE-USUWREDASA-N |
| XLogP | 4.96 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.89 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|