C20H38O4Si2 — CID 11327011
(2S,3R,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-propan-2-yloxy-4-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-3-ol (PubChem CID 11327011) has the molecular formula C20H38O4Si2 and a molecular weight of 398.69 g/mol. Its IUPAC name is (2S,3R,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-propan-2-yloxy-4-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-3-ol.
| Compound Name | (2S,3R,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-propan-2-yloxy-4-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-3-ol |
|---|---|
| PubChem CID | 11327011 |
| Molecular Formula | C20H38O4Si2 |
| Molecular Weight | 398.69 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | (2S,3R,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-propan-2-yloxy-4-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-3-ol |
| SMILES | CC(C)O[C@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)C=C(C#C[Si](C)(C)C)[C@H]1O |
| InChI | InChI=1S/C20H38O4Si2/c1-15(2)23-19-18(21)16(11-12-25(6,7)8)13-17(24-19)14-22-26(9,10)20(3,4)5/h13,15,17-19,21H,14H2,1-10H3/t17-,18+,19-/m0/s1 |
| InChIKey | UVYILGYBOAXSQL-OTWHNJEPSA-N |
| XLogP | 4.33 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.69 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|