C19H28ClNO4SSi — CID 11327868
methyl 2-[(4-chlorophenyl)-[prop-2-enyl(2-trimethylsilylethylsulfonyl)amino]methyl]prop-2-enoate (PubChem CID 11327868) has the molecular formula C19H28ClNO4SSi and a molecular weight of 430.04 g/mol. Its IUPAC name is methyl 2-[(4-chlorophenyl)-[prop-2-enyl(2-trimethylsilylethylsulfonyl)amino]methyl]prop-2-enoate.
| Compound Name | methyl 2-[(4-chlorophenyl)-[prop-2-enyl(2-trimethylsilylethylsulfonyl)amino]methyl]prop-2-enoate |
|---|---|
| PubChem CID | 11327868 |
| Molecular Formula | C19H28ClNO4SSi |
| Molecular Weight | 430.04 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | methyl 2-[(4-chlorophenyl)-[prop-2-enyl(2-trimethylsilylethylsulfonyl)amino]methyl]prop-2-enoate |
| SMILES | C=CCN(C(C(=C)C(=O)OC)c1ccc(Cl)cc1)S(=O)(=O)CC[Si](C)(C)C |
| InChI | InChI=1S/C19H28ClNO4SSi/c1-7-12-21(26(23,24)13-14-27(4,5)6)18(15(2)19(22)25-3)16-8-10-17(20)11-9-16/h7-11,18H,1-2,12-14H2,3-6H3 |
| InChIKey | LXDOJPBNFUYCPL-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.04 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|