C24H50O5Si2 — CID 11328989
(E,7S,8R,9R)-7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-9-hydroxydodec-5-enoic acid (PubChem CID 11328989) has the molecular formula C24H50O5Si2 and a molecular weight of 474.83 g/mol. Its IUPAC name is (E,7S,8R,9R)-7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-9-hydroxydodec-5-enoic acid.
| Compound Name | (E,7S,8R,9R)-7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-9-hydroxydodec-5-enoic acid |
|---|---|
| PubChem CID | 11328989 |
| Molecular Formula | C24H50O5Si2 |
| Molecular Weight | 474.83 g/mol |
| Exact Mass | 474.32 |
| IUPAC Name | (E,7S,8R,9R)-7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-9-hydroxydodec-5-enoic acid |
| SMILES | CCC[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](/C=C/CCCC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H50O5Si2/c1-12-16-19(25)22(29-31(10,11)24(5,6)7)20(17-14-13-15-18-21(26)27)28-30(8,9)23(2,3)4/h14,17,19-20,22,25H,12-13,15-16,18H2,1-11H3,(H,26,27)/b17-14+/t19-,20+,22-/m1/s1 |
| InChIKey | ZGCJCQXWUDDGQB-TWXPYHKPSA-N |
| XLogP | 6.74 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.83 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|