C13H17NO2S — CID 113318334
7,8-dimethyl-3,7,8,9-tetrahydro-2H-thiopyrano[2,3-g][1,4]benzodioxin-9-amine (PubChem CID 113318334) has the molecular formula C13H17NO2S and a molecular weight of 251.35 g/mol. Its IUPAC name is 7,8-dimethyl-3,7,8,9-tetrahydro-2H-thiopyrano[2,3-g][1,4]benzodioxin-9-amine.
| Compound Name | 7,8-dimethyl-3,7,8,9-tetrahydro-2H-thiopyrano[2,3-g][1,4]benzodioxin-9-amine |
|---|---|
| PubChem CID | 113318334 |
| Molecular Formula | C13H17NO2S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 7,8-dimethyl-3,7,8,9-tetrahydro-2H-thiopyrano[2,3-g][1,4]benzodioxin-9-amine |
| SMILES | CC1Sc2cc3c(cc2C(N)C1C)OCCO3 |
| InChI | InChI=1S/C13H17NO2S/c1-7-8(2)17-12-6-11-10(15-3-4-16-11)5-9(12)13(7)14/h5-8,13H,3-4,14H2,1-2H3 |
| InChIKey | INZQTRFNDZAAHK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |