C13H17NO2 — CID 63822811
9-methyl-2,3,4,7,8,9-hexahydrocyclopenta[h][1,5]benzodioxepin-7-amine (PubChem CID 63822811) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 9-methyl-2,3,4,7,8,9-hexahydrocyclopenta[h][1,5]benzodioxepin-7-amine.
| Compound Name | 9-methyl-2,3,4,7,8,9-hexahydrocyclopenta[h][1,5]benzodioxepin-7-amine |
|---|---|
| PubChem CID | 63822811 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 9-methyl-2,3,4,7,8,9-hexahydrocyclopenta[h][1,5]benzodioxepin-7-amine |
| SMILES | CC1CC(N)c2cc3c(cc21)OCCCO3 |
| InChI | InChI=1S/C13H17NO2/c1-8-5-11(14)10-7-13-12(6-9(8)10)15-3-2-4-16-13/h6-8,11H,2-5,14H2,1H3 |
| InChIKey | ASRNLQOCJDRSHB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |