C7H10O3 — CID 11332524
(4R)-2-methoxy-4-prop-1-ynyl-1,3-dioxolane (PubChem CID 11332524) has the molecular formula C7H10O3 and a molecular weight of 142.15 g/mol. Its IUPAC name is (4R)-2-methoxy-4-prop-1-ynyl-1,3-dioxolane.
| Compound Name | (4R)-2-methoxy-4-prop-1-ynyl-1,3-dioxolane |
|---|---|
| PubChem CID | 11332524 |
| Molecular Formula | C7H10O3 |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | (4R)-2-methoxy-4-prop-1-ynyl-1,3-dioxolane |
| SMILES | CC#C[C@@H]1COC(OC)O1 |
| InChI | InChI=1S/C7H10O3/c1-3-4-6-5-9-7(8-2)10-6/h6-7H,5H2,1-2H3/t6-,7?/m1/s1 |
| InChIKey | LXMJQPFYZHOGBQ-ULUSZKPHSA-N |
| XLogP | 0.36 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|