C6H12O3 — CID 13356634
(2R,4R)-2-methoxy-4-methyl-1,3-dioxane (PubChem CID 13356634) has the molecular formula C6H12O3 and a molecular weight of 132.16 g/mol. Its IUPAC name is (2R,4R)-2-methoxy-4-methyl-1,3-dioxane.
| Compound Name | (2R,4R)-2-methoxy-4-methyl-1,3-dioxane |
|---|---|
| PubChem CID | 13356634 |
| Molecular Formula | C6H12O3 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | (2R,4R)-2-methoxy-4-methyl-1,3-dioxane |
| SMILES | CO[C@@H]1OCC[C@@H](C)O1 |
| InChI | InChI=1S/C6H12O3/c1-5-3-4-8-6(7-2)9-5/h5-6H,3-4H2,1-2H3/t5-,6-/m1/s1 |
| InChIKey | PPNFCQJTRMEVLI-PHDIDXHHSA-N |
| XLogP | 0.74 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |