C26H31NO4 — CID 11339194
(2R)-2-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1-benzyl-3,6-dihydro-2H-pyridine (PubChem CID 11339194) has the molecular formula C26H31NO4 and a molecular weight of 421.54 g/mol. Its IUPAC name is (2R)-2-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1-benzyl-3,6-dihydro-2H-pyridine.
| Compound Name | (2R)-2-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1-benzyl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 11339194 |
| Molecular Formula | C26H31NO4 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | (2R)-2-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1-benzyl-3,6-dihydro-2H-pyridine |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@H]3CC=CCN3Cc3ccccc3)[C@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C26H31NO4/c1-26(2)30-24-23(28-18-20-13-7-4-8-14-20)22(29-25(24)31-26)21-15-9-10-16-27(21)17-19-11-5-3-6-12-19/h3-14,21-25H,15-18H2,1-2H3/t21-,22-,23+,24-,25-/m1/s1 |
| InChIKey | CRPBHUAMXXMGDF-NHTNDUFYSA-N |
| XLogP | 4.28 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|