C14H23NO2S — CID 113421969
2-methylsulfonyl-1-(2,3,5,6-tetramethylphenyl)propan-1-amine (PubChem CID 113421969) has the molecular formula C14H23NO2S and a molecular weight of 269.41 g/mol. Its IUPAC name is 2-methylsulfonyl-1-(2,3,5,6-tetramethylphenyl)propan-1-amine.
| Compound Name | 2-methylsulfonyl-1-(2,3,5,6-tetramethylphenyl)propan-1-amine |
|---|---|
| PubChem CID | 113421969 |
| Molecular Formula | C14H23NO2S |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 2-methylsulfonyl-1-(2,3,5,6-tetramethylphenyl)propan-1-amine |
| SMILES | Cc1cc(C)c(C)c(C(N)C(C)S(C)(=O)=O)c1C |
| InChI | InChI=1S/C14H23NO2S/c1-8-7-9(2)11(4)13(10(8)3)14(15)12(5)18(6,16)17/h7,12,14H,15H2,1-6H3 |
| InChIKey | RMGYVDYGUOZKRC-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |