C22H20Cl2F3N5O4S2 — CID 11342496
N-(4-chlorophenyl)-2-[5-[[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]butanoylamino]sulfamoyl]thiophen-2-yl]acetamide (PubChem CID 11342496) has the molecular formula C22H20Cl2F3N5O4S2 and a molecular weight of 610.47 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[5-[[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]butanoylamino]sulfamoyl]thiophen-2-yl]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[5-[[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]butanoylamino]sulfamoyl]thiophen-2-yl]acetamide |
|---|---|
| PubChem CID | 11342496 |
| Molecular Formula | C22H20Cl2F3N5O4S2 |
| Molecular Weight | 610.47 g/mol |
| Exact Mass | 609.03 |
| IUPAC Name | N-(4-chlorophenyl)-2-[5-[[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]butanoylamino]sulfamoyl]thiophen-2-yl]acetamide |
| SMILES | O=C(CCCNc1ncc(C(F)(F)F)cc1Cl)NNS(=O)(=O)c1ccc(CC(=O)Nc2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C22H20Cl2F3N5O4S2/c23-14-3-5-15(6-4-14)30-19(34)11-16-7-8-20(37-16)38(35,36)32-31-18(33)2-1-9-28-21-17(24)10-13(12-29-21)22(25,26)27/h3-8,10,12,32H,1-2,9,11H2,(H,28,29)(H,30,34)(H,31,33) |
| InChIKey | UEBDXPRUGHDZRH-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 129.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.47 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|