C24H25ClF3N5O4S2 — CID 11433417
N-[[5-[[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]butanoylamino]sulfamoyl]thiophen-2-yl]methyl]-3-phenylpropanamide (PubChem CID 11433417) has the molecular formula C24H25ClF3N5O4S2 and a molecular weight of 604.08 g/mol. Its IUPAC name is N-[[5-[[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]butanoylamino]sulfamoyl]thiophen-2-yl]methyl]-3-phenylpropanamide.
| Compound Name | N-[[5-[[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]butanoylamino]sulfamoyl]thiophen-2-yl]methyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 11433417 |
| Molecular Formula | C24H25ClF3N5O4S2 |
| Molecular Weight | 604.08 g/mol |
| Exact Mass | 603.10 |
| IUPAC Name | N-[[5-[[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]butanoylamino]sulfamoyl]thiophen-2-yl]methyl]-3-phenylpropanamide |
| SMILES | O=C(CCc1ccccc1)NCc1ccc(S(=O)(=O)NNC(=O)CCCNc2ncc(C(F)(F)F)cc2Cl)s1 |
| InChI | InChI=1S/C24H25ClF3N5O4S2/c25-19-13-17(24(26,27)28)14-31-23(19)29-12-4-7-21(35)32-33-39(36,37)22-11-9-18(38-22)15-30-20(34)10-8-16-5-2-1-3-6-16/h1-3,5-6,9,11,13-14,33H,4,7-8,10,12,15H2,(H,29,31)(H,30,34)(H,32,35) |
| InChIKey | DWSZUVYTDCDFKM-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 129.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.08 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|