C20H18ClF3N6O — CID 27163370
(E)-3-(1-benzyltriazol-4-yl)-N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]prop-2-enamide (PubChem CID 27163370) has the molecular formula C20H18ClF3N6O and a molecular weight of 450.85 g/mol. Its IUPAC name is (E)-3-(1-benzyltriazol-4-yl)-N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]prop-2-enamide.
| Compound Name | (E)-3-(1-benzyltriazol-4-yl)-N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 27163370 |
| Molecular Formula | C20H18ClF3N6O |
| Molecular Weight | 450.85 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | (E)-3-(1-benzyltriazol-4-yl)-N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cn(Cc2ccccc2)nn1)NCCNc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C20H18ClF3N6O/c21-17-10-15(20(22,23)24)11-27-19(17)26-9-8-25-18(31)7-6-16-13-30(29-28-16)12-14-4-2-1-3-5-14/h1-7,10-11,13H,8-9,12H2,(H,25,31)(H,26,27)/b7-6+ |
| InChIKey | YOWNNLWRIXTBTM-VOTSOKGWSA-N |
| XLogP | 3.64 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.85 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|