C34H48O12 — CID 11342725
methyl (2S,3R,4S)-3,4-diacetyloxy-2-[6-(5,5-dimethyl-6-oxo-6-phenylmethoxyhexoxy)-2,2-dimethylhexanoyl]oxy-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 11342725) has the molecular formula C34H48O12 and a molecular weight of 648.75 g/mol. Its IUPAC name is methyl (2S,3R,4S)-3,4-diacetyloxy-2-[6-(5,5-dimethyl-6-oxo-6-phenylmethoxyhexoxy)-2,2-dimethylhexanoyl]oxy-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | methyl (2S,3R,4S)-3,4-diacetyloxy-2-[6-(5,5-dimethyl-6-oxo-6-phenylmethoxyhexoxy)-2,2-dimethylhexanoyl]oxy-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 11342725 |
| Molecular Formula | C34H48O12 |
| Molecular Weight | 648.75 g/mol |
| Exact Mass | 648.31 |
| IUPAC Name | methyl (2S,3R,4S)-3,4-diacetyloxy-2-[6-(5,5-dimethyl-6-oxo-6-phenylmethoxyhexoxy)-2,2-dimethylhexanoyl]oxy-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | COC(=O)C1=C[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(=O)C(C)(C)CCCCOCCCCC(C)(C)C(=O)OCc2ccccc2)O1 |
| InChI | InChI=1S/C34H48O12/c1-23(35)43-26-21-27(29(37)40-7)45-30(28(26)44-24(2)36)46-32(39)34(5,6)18-12-14-20-41-19-13-11-17-33(3,4)31(38)42-22-25-15-9-8-10-16-25/h8-10,15-16,21,26,28,30H,11-14,17-20,22H2,1-7H3/t26-,28+,30-/m0/s1 |
| InChIKey | YKDSBFWBVSLTBX-ZFOGOZASSA-N |
| XLogP | 4.96 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.75 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|