C45H55NO8Si — CID 11343234
prop-2-enyl (Z,4R,5S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-4,5,7-tris(phenylmethoxy)-2-(phenylmethoxycarbonylamino)hept-2-enoate (PubChem CID 11343234) has the molecular formula C45H55NO8Si and a molecular weight of 766.02 g/mol. Its IUPAC name is prop-2-enyl (Z,4R,5S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-4,5,7-tris(phenylmethoxy)-2-(phenylmethoxycarbonylamino)hept-2-enoate.
| Compound Name | prop-2-enyl (Z,4R,5S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-4,5,7-tris(phenylmethoxy)-2-(phenylmethoxycarbonylamino)hept-2-enoate |
|---|---|
| PubChem CID | 11343234 |
| Molecular Formula | C45H55NO8Si |
| Molecular Weight | 766.02 g/mol |
| Exact Mass | 765.37 |
| IUPAC Name | prop-2-enyl (Z,4R,5S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-4,5,7-tris(phenylmethoxy)-2-(phenylmethoxycarbonylamino)hept-2-enoate |
| SMILES | C=CCOC(=O)/C(=C/[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](COCc1ccccc1)O[Si](C)(C)C(C)(C)C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C45H55NO8Si/c1-7-28-50-43(47)39(46-44(48)53-33-38-26-18-11-19-27-38)29-40(51-31-36-22-14-9-15-23-36)42(52-32-37-24-16-10-17-25-37)41(54-55(5,6)45(2,3)4)34-49-30-35-20-12-8-13-21-35/h7-27,29,40-42H,1,28,30-34H2,2-6H3,(H,46,48)/b39-29-/t40-,41-,42+/m1/s1 |
| InChIKey | NJLZLFICRGKSBU-KSCCORGCSA-N |
| XLogP | 9.30 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.02 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|