C15H23Cl2N3O2S — CID 11349505
4-[2-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]ethyl]morpholine;dihydrochloride (PubChem CID 11349505) has the molecular formula C15H23Cl2N3O2S and a molecular weight of 380.34 g/mol. Its IUPAC name is 4-[2-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]ethyl]morpholine;dihydrochloride.
| Compound Name | 4-[2-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]ethyl]morpholine;dihydrochloride |
|---|---|
| PubChem CID | 11349505 |
| Molecular Formula | C15H23Cl2N3O2S |
| Molecular Weight | 380.34 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 4-[2-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]ethyl]morpholine;dihydrochloride |
| SMILES | CCOc1ccc2nc(SCCN3CCOCC3)[nH]c2c1.Cl.Cl |
| InChI | InChI=1S/C15H21N3O2S.2ClH/c1-2-20-12-3-4-13-14(11-12)17-15(16-13)21-10-7-18-5-8-19-9-6-18;;/h3-4,11H,2,5-10H2,1H3,(H,16,17);2*1H |
| InChIKey | OFMVMQZFMVQDFO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 50.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.34 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |