C15H22ClN3O2S — CID 11725026
2-[2-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]ethyl]morpholine;hydrochloride (PubChem CID 11725026) has the molecular formula C15H22ClN3O2S and a molecular weight of 343.88 g/mol. Its IUPAC name is 2-[2-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]ethyl]morpholine;hydrochloride.
| Compound Name | 2-[2-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]ethyl]morpholine;hydrochloride |
|---|---|
| PubChem CID | 11725026 |
| Molecular Formula | C15H22ClN3O2S |
| Molecular Weight | 343.88 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 2-[2-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]ethyl]morpholine;hydrochloride |
| SMILES | CCOc1ccc2nc(SCCC3CNCCO3)[nH]c2c1.Cl |
| InChI | InChI=1S/C15H21N3O2S.ClH/c1-2-19-11-3-4-13-14(9-11)18-15(17-13)21-8-5-12-10-16-6-7-20-12;/h3-4,9,12,16H,2,5-8,10H2,1H3,(H,17,18);1H |
| InChIKey | YODLWNBUXDWOKY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.88 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |