C20H39ISi — CID 11351018
[(2E,4Z)-3-hexyl-5-iodoundeca-2,4-dien-2-yl]-trimethylsilane (PubChem CID 11351018) has the molecular formula C20H39ISi and a molecular weight of 434.52 g/mol. Its IUPAC name is [(2E,4Z)-3-hexyl-5-iodoundeca-2,4-dien-2-yl]-trimethylsilane.
| Compound Name | [(2E,4Z)-3-hexyl-5-iodoundeca-2,4-dien-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 11351018 |
| Molecular Formula | C20H39ISi |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | [(2E,4Z)-3-hexyl-5-iodoundeca-2,4-dien-2-yl]-trimethylsilane |
| SMILES | CCCCCC/C(I)=C/C(CCCCCC)=C(\C)[Si](C)(C)C |
| InChI | InChI=1S/C20H39ISi/c1-7-9-11-13-15-19(18(3)22(4,5)6)17-20(21)16-14-12-10-8-2/h17H,7-16H2,1-6H3/b19-18+,20-17- |
| InChIKey | OMLDPTGXQGRQQM-OPMYVQNQSA-N |
| XLogP | 8.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|