C32H39NO7 — CID 11353358
ethyl 2-[(2R,4R)-4-hydroxy-1-[2-[tris(4-methoxyphenyl)methoxy]ethyl]pyrrolidin-2-yl]acetate (PubChem CID 11353358) has the molecular formula C32H39NO7 and a molecular weight of 549.66 g/mol. Its IUPAC name is ethyl 2-[(2R,4R)-4-hydroxy-1-[2-[tris(4-methoxyphenyl)methoxy]ethyl]pyrrolidin-2-yl]acetate.
| Compound Name | ethyl 2-[(2R,4R)-4-hydroxy-1-[2-[tris(4-methoxyphenyl)methoxy]ethyl]pyrrolidin-2-yl]acetate |
|---|---|
| PubChem CID | 11353358 |
| Molecular Formula | C32H39NO7 |
| Molecular Weight | 549.66 g/mol |
| Exact Mass | 549.27 |
| IUPAC Name | ethyl 2-[(2R,4R)-4-hydroxy-1-[2-[tris(4-methoxyphenyl)methoxy]ethyl]pyrrolidin-2-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1C[C@@H](O)CN1CCOC(c1ccc(OC)cc1)(c1ccc(OC)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C32H39NO7/c1-5-39-31(35)21-26-20-27(34)22-33(26)18-19-40-32(23-6-12-28(36-2)13-7-23,24-8-14-29(37-3)15-9-24)25-10-16-30(38-4)17-11-25/h6-17,26-27,34H,5,18-22H2,1-4H3/t26-,27-/m1/s1 |
| InChIKey | NQRZKPCOUUQCDA-KAYWLYCHSA-N |
| XLogP | 4.41 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.66 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|