C22H33NO2 — CID 11359873
tert-butyl N-ethyl-N-(1-phenyl-2-prop-1-enylidenehexyl)carbamate (PubChem CID 11359873) has the molecular formula C22H33NO2 and a molecular weight of 343.51 g/mol. Its IUPAC name is tert-butyl N-ethyl-N-(1-phenyl-2-prop-1-enylidenehexyl)carbamate.
| Compound Name | tert-butyl N-ethyl-N-(1-phenyl-2-prop-1-enylidenehexyl)carbamate |
|---|---|
| PubChem CID | 11359873 |
| Molecular Formula | C22H33NO2 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.25 |
| IUPAC Name | tert-butyl N-ethyl-N-(1-phenyl-2-prop-1-enylidenehexyl)carbamate |
| SMILES | CC=C=C(CCCC)C(c1ccccc1)N(CC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H33NO2/c1-7-10-15-18(14-8-2)20(19-16-12-11-13-17-19)23(9-3)21(24)25-22(4,5)6/h8,11-13,16-17,20H,7,9-10,15H2,1-6H3 |
| InChIKey | DEFSRAHVHZEOFE-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |