C19H35NO4Si — CID 11360689
tert-butyl N-but-3-enyl-N-[4-[tert-butyl(dimethyl)silyl]oxybut-2-ynoxy]carbamate (PubChem CID 11360689) has the molecular formula C19H35NO4Si and a molecular weight of 369.58 g/mol. Its IUPAC name is tert-butyl N-but-3-enyl-N-[4-[tert-butyl(dimethyl)silyl]oxybut-2-ynoxy]carbamate.
| Compound Name | tert-butyl N-but-3-enyl-N-[4-[tert-butyl(dimethyl)silyl]oxybut-2-ynoxy]carbamate |
|---|---|
| PubChem CID | 11360689 |
| Molecular Formula | C19H35NO4Si |
| Molecular Weight | 369.58 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | tert-butyl N-but-3-enyl-N-[4-[tert-butyl(dimethyl)silyl]oxybut-2-ynoxy]carbamate |
| SMILES | C=CCCN(OCC#CCO[Si](C)(C)C(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H35NO4Si/c1-10-11-14-20(17(21)24-18(2,3)4)22-15-12-13-16-23-25(8,9)19(5,6)7/h10H,1,11,14-16H2,2-9H3 |
| InChIKey | CNTRHSDGCRENEK-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.58 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|