C8H14O5S — CID 11368037
S-[[(2S,3S,4R,5R)-3,4-dihydroxy-5-methoxyoxolan-2-yl]methyl] ethanethioate (PubChem CID 11368037) has the molecular formula C8H14O5S and a molecular weight of 222.26 g/mol. Its IUPAC name is S-[[(2S,3S,4R,5R)-3,4-dihydroxy-5-methoxyoxolan-2-yl]methyl] ethanethioate.
| Compound Name | S-[[(2S,3S,4R,5R)-3,4-dihydroxy-5-methoxyoxolan-2-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 11368037 |
| Molecular Formula | C8H14O5S |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | S-[[(2S,3S,4R,5R)-3,4-dihydroxy-5-methoxyoxolan-2-yl]methyl] ethanethioate |
| SMILES | CO[C@@H]1O[C@H](CSC(C)=O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C8H14O5S/c1-4(9)14-3-5-6(10)7(11)8(12-2)13-5/h5-8,10-11H,3H2,1-2H3/t5-,6-,7-,8-/m1/s1 |
| InChIKey | QNSNYPGFASZUGB-WCTZXXKLSA-N |
| XLogP | -0.64 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|