C24H34O5 — CID 11373033
[(1R,3E,6S,8S,10R,11R,12S,15S)-11-acetyloxy-10-hydroxy-6,12,16-trimethyl-2-methylidene-8-tricyclo[7.5.2.012,15]hexadeca-3,9(16)-dienyl] acetate (PubChem CID 11373033) has the molecular formula C24H34O5 and a molecular weight of 402.53 g/mol. Its IUPAC name is [(1R,3E,6S,8S,10R,11R,12S,15S)-11-acetyloxy-10-hydroxy-6,12,16-trimethyl-2-methylidene-8-tricyclo[7.5.2.012,15]hexadeca-3,9(16)-dienyl] acetate.
| Compound Name | [(1R,3E,6S,8S,10R,11R,12S,15S)-11-acetyloxy-10-hydroxy-6,12,16-trimethyl-2-methylidene-8-tricyclo[7.5.2.012,15]hexadeca-3,9(16)-dienyl] acetate |
|---|---|
| PubChem CID | 11373033 |
| Molecular Formula | C24H34O5 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | [(1R,3E,6S,8S,10R,11R,12S,15S)-11-acetyloxy-10-hydroxy-6,12,16-trimethyl-2-methylidene-8-tricyclo[7.5.2.012,15]hexadeca-3,9(16)-dienyl] acetate |
| SMILES | C=C1/C=C\C[C@H](C)C[C@H](OC(C)=O)C2=C(C)[C@@H]3[C@H]1CC[C@]3(C)[C@@H](OC(C)=O)[C@@H]2O |
| InChI | InChI=1S/C24H34O5/c1-13-8-7-9-14(2)18-10-11-24(6)21(18)15(3)20(19(12-13)28-16(4)25)22(27)23(24)29-17(5)26/h7,9,13,18-19,21-23,27H,2,8,10-12H2,1,3-6H3/b9-7-/t13-,18-,19-,21+,22+,23-,24-/m0/s1 |
| InChIKey | MUFPONHNLINTSX-TXHCGIBHSA-N |
| XLogP | 4.12 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|