C26H32O7 — CID 11374491
(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-8-[(2-phenyl-4,5,6,7-tetrahydro-1-benzofuran-4-yl)oxymethyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane (PubChem CID 11374491) has the molecular formula C26H32O7 and a molecular weight of 456.54 g/mol. Its IUPAC name is (1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-8-[(2-phenyl-4,5,6,7-tetrahydro-1-benzofuran-4-yl)oxymethyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane.
| Compound Name | (1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-8-[(2-phenyl-4,5,6,7-tetrahydro-1-benzofuran-4-yl)oxymethyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
|---|---|
| PubChem CID | 11374491 |
| Molecular Formula | C26H32O7 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | (1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-8-[(2-phenyl-4,5,6,7-tetrahydro-1-benzofuran-4-yl)oxymethyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
| SMILES | CC1(C)O[C@H]2[C@@H](O1)[C@@H](COC1CCCc3oc(-c4ccccc4)cc31)O[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C26H32O7/c1-25(2)30-21-20(29-24-23(22(21)31-25)32-26(3,4)33-24)14-27-17-11-8-12-18-16(17)13-19(28-18)15-9-6-5-7-10-15/h5-7,9-10,13,17,20-24H,8,11-12,14H2,1-4H3/t17?,20-,21+,22+,23-,24-/m1/s1 |
| InChIKey | RSRYBALHCTUYSB-CZFIWYJGSA-N |
| XLogP | 4.74 |
| TPSA | 68.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |