C32H56O2Si — CID 11375487
(6R)-1-[tert-butyl(dimethyl)silyl]oxy-24-methylpentacosa-2,4,16-triyn-6-ol (PubChem CID 11375487) has the molecular formula C32H56O2Si and a molecular weight of 500.88 g/mol. Its IUPAC name is (6R)-1-[tert-butyl(dimethyl)silyl]oxy-24-methylpentacosa-2,4,16-triyn-6-ol.
| Compound Name | (6R)-1-[tert-butyl(dimethyl)silyl]oxy-24-methylpentacosa-2,4,16-triyn-6-ol |
|---|---|
| PubChem CID | 11375487 |
| Molecular Formula | C32H56O2Si |
| Molecular Weight | 500.88 g/mol |
| Exact Mass | 500.40 |
| IUPAC Name | (6R)-1-[tert-butyl(dimethyl)silyl]oxy-24-methylpentacosa-2,4,16-triyn-6-ol |
| SMILES | CC(C)CCCCCCC#CCCCCCCCCC[C@@H](O)C#CC#CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H56O2Si/c1-30(2)26-22-19-17-15-13-11-9-8-10-12-14-16-18-20-23-27-31(33)28-24-21-25-29-34-35(6,7)32(3,4)5/h30-31,33H,8,10,12-20,22-23,26-27,29H2,1-7H3/t31-/m1/s1 |
| InChIKey | DPBWXJXDGGFJNM-WJOKGBTCSA-N |
| XLogP | 8.89 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.88 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|