C13H19ClOSi — CID 11379820
chloro-dimethyl-[(1S,2R)-2-methyl-1-phenylbut-3-enoxy]silane (PubChem CID 11379820) has the molecular formula C13H19ClOSi and a molecular weight of 254.83 g/mol. Its IUPAC name is chloro-dimethyl-[(1S,2R)-2-methyl-1-phenylbut-3-enoxy]silane.
| Compound Name | chloro-dimethyl-[(1S,2R)-2-methyl-1-phenylbut-3-enoxy]silane |
|---|---|
| PubChem CID | 11379820 |
| Molecular Formula | C13H19ClOSi |
| Molecular Weight | 254.83 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | chloro-dimethyl-[(1S,2R)-2-methyl-1-phenylbut-3-enoxy]silane |
| SMILES | C=C[C@@H](C)[C@H](O[Si](C)(C)Cl)c1ccccc1 |
| InChI | InChI=1S/C13H19ClOSi/c1-5-11(2)13(15-16(3,4)14)12-9-7-6-8-10-12/h5-11,13H,1H2,2-4H3/t11-,13+/m1/s1 |
| InChIKey | DYMWDUBJUBMJNB-YPMHNXCESA-N |
| XLogP | 4.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.83 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|