C20H28O5S2 — CID 11384390
3-[2-[(2-formyl-3,5-dimethoxy-4-methylphenyl)methyl]-1,3-dithian-2-yl]propyl acetate (PubChem CID 11384390) has the molecular formula C20H28O5S2 and a molecular weight of 412.57 g/mol. Its IUPAC name is 3-[2-[(2-formyl-3,5-dimethoxy-4-methylphenyl)methyl]-1,3-dithian-2-yl]propyl acetate.
| Compound Name | 3-[2-[(2-formyl-3,5-dimethoxy-4-methylphenyl)methyl]-1,3-dithian-2-yl]propyl acetate |
|---|---|
| PubChem CID | 11384390 |
| Molecular Formula | C20H28O5S2 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 3-[2-[(2-formyl-3,5-dimethoxy-4-methylphenyl)methyl]-1,3-dithian-2-yl]propyl acetate |
| SMILES | COc1cc(CC2(CCCOC(C)=O)SCCCS2)c(C=O)c(OC)c1C |
| InChI | InChI=1S/C20H28O5S2/c1-14-18(23-3)11-16(17(13-21)19(14)24-4)12-20(26-9-6-10-27-20)7-5-8-25-15(2)22/h11,13H,5-10,12H2,1-4H3 |
| InChIKey | ULOVTLNOFYQQFM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|