C16H21IO4S — CID 11385033
2-[(E,2S)-5-(benzenesulfonyl)-1-iodopent-3-en-2-yl]oxyoxane (PubChem CID 11385033) has the molecular formula C16H21IO4S and a molecular weight of 436.31 g/mol. Its IUPAC name is 2-[(E,2S)-5-(benzenesulfonyl)-1-iodopent-3-en-2-yl]oxyoxane.
| Compound Name | 2-[(E,2S)-5-(benzenesulfonyl)-1-iodopent-3-en-2-yl]oxyoxane |
|---|---|
| PubChem CID | 11385033 |
| Molecular Formula | C16H21IO4S |
| Molecular Weight | 436.31 g/mol |
| Exact Mass | 436.02 |
| IUPAC Name | 2-[(E,2S)-5-(benzenesulfonyl)-1-iodopent-3-en-2-yl]oxyoxane |
| SMILES | O=S(=O)(C/C=C/[C@@H](CI)OC1CCCCO1)c1ccccc1 |
| InChI | InChI=1S/C16H21IO4S/c17-13-14(21-16-10-4-5-11-20-16)7-6-12-22(18,19)15-8-2-1-3-9-15/h1-3,6-9,14,16H,4-5,10-13H2/b7-6+/t14-,16?/m0/s1 |
| InChIKey | XQKJPZNKLDAOLZ-SGQQGVAGSA-N |
| XLogP | 3.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.31 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|