C24H41NO4Si — CID 11396426
[(3R,4R,5S)-4-hydroxy-5-phenylmethoxy-2-(trimethylsilylmethyl)hex-1-en-3-yl] N,N-di(propan-2-yl)carbamate (PubChem CID 11396426) has the molecular formula C24H41NO4Si and a molecular weight of 435.68 g/mol. Its IUPAC name is [(3R,4R,5S)-4-hydroxy-5-phenylmethoxy-2-(trimethylsilylmethyl)hex-1-en-3-yl] N,N-di(propan-2-yl)carbamate.
| Compound Name | [(3R,4R,5S)-4-hydroxy-5-phenylmethoxy-2-(trimethylsilylmethyl)hex-1-en-3-yl] N,N-di(propan-2-yl)carbamate |
|---|---|
| PubChem CID | 11396426 |
| Molecular Formula | C24H41NO4Si |
| Molecular Weight | 435.68 g/mol |
| Exact Mass | 435.28 |
| IUPAC Name | [(3R,4R,5S)-4-hydroxy-5-phenylmethoxy-2-(trimethylsilylmethyl)hex-1-en-3-yl] N,N-di(propan-2-yl)carbamate |
| SMILES | C=C(C[Si](C)(C)C)[C@@H](OC(=O)N(C(C)C)C(C)C)[C@H](O)[C@H](C)OCc1ccccc1 |
| InChI | InChI=1S/C24H41NO4Si/c1-17(2)25(18(3)4)24(27)29-23(19(5)16-30(7,8)9)22(26)20(6)28-15-21-13-11-10-12-14-21/h10-14,17-18,20,22-23,26H,5,15-16H2,1-4,6-9H3/t20-,22+,23+/m0/s1 |
| InChIKey | UYMMRDKGVDQIFV-MDNUFGMLSA-N |
| XLogP | 5.47 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.68 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|