C14H22O4 — CID 11402562
(1S,2S)-1,2-bis[(2S)-4-methyl-3,6-dihydro-2H-pyran-2-yl]ethane-1,2-diol (PubChem CID 11402562) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is (1S,2S)-1,2-bis[(2S)-4-methyl-3,6-dihydro-2H-pyran-2-yl]ethane-1,2-diol.
| Compound Name | (1S,2S)-1,2-bis[(2S)-4-methyl-3,6-dihydro-2H-pyran-2-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 11402562 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | (1S,2S)-1,2-bis[(2S)-4-methyl-3,6-dihydro-2H-pyran-2-yl]ethane-1,2-diol |
| SMILES | CC1=CCO[C@H]([C@@H](O)[C@H](O)[C@@H]2CC(C)=CCO2)C1 |
| InChI | InChI=1S/C14H22O4/c1-9-3-5-17-11(7-9)13(15)14(16)12-8-10(2)4-6-18-12/h3-4,11-16H,5-8H2,1-2H3/t11-,12-,13+,14+/m0/s1 |
| InChIKey | FEDDQBVINZMZSE-IGQOVBAYSA-N |
| XLogP | 1.18 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|