C11H16FN3O2S — CID 114035105
5-fluoro-2-(methylamino)-N-(3-methylsulfinylpropyl)pyridine-3-carboxamide (PubChem CID 114035105) has the molecular formula C11H16FN3O2S and a molecular weight of 273.33 g/mol. Its IUPAC name is 5-fluoro-2-(methylamino)-N-(3-methylsulfinylpropyl)pyridine-3-carboxamide.
| Compound Name | 5-fluoro-2-(methylamino)-N-(3-methylsulfinylpropyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 114035105 |
| Molecular Formula | C11H16FN3O2S |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 5-fluoro-2-(methylamino)-N-(3-methylsulfinylpropyl)pyridine-3-carboxamide |
| SMILES | CNc1ncc(F)cc1C(=O)NCCCS(C)=O |
| InChI | InChI=1S/C11H16FN3O2S/c1-13-10-9(6-8(12)7-15-10)11(16)14-4-3-5-18(2)17/h6-7H,3-5H2,1-2H3,(H,13,15)(H,14,16) |
| InChIKey | MSWQHQDSGRPVPT-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|