C25H52O2Si3 — CID 11408767
[(E)-3,8-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4-dimethyloct-6-en-1-ynyl]-trimethylsilane (PubChem CID 11408767) has the molecular formula C25H52O2Si3 and a molecular weight of 468.95 g/mol. Its IUPAC name is [(E)-3,8-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4-dimethyloct-6-en-1-ynyl]-trimethylsilane.
| Compound Name | [(E)-3,8-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4-dimethyloct-6-en-1-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 11408767 |
| Molecular Formula | C25H52O2Si3 |
| Molecular Weight | 468.95 g/mol |
| Exact Mass | 468.33 |
| IUPAC Name | [(E)-3,8-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4-dimethyloct-6-en-1-ynyl]-trimethylsilane |
| SMILES | CC(C)(C/C=C/CO[Si](C)(C)C(C)(C)C)C(C#C[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H52O2Si3/c1-23(2,3)29(12,13)26-20-17-16-19-25(7,8)22(18-21-28(9,10)11)27-30(14,15)24(4,5)6/h16-17,22H,19-20H2,1-15H3/b17-16+ |
| InChIKey | BOWVMYJENSJJCK-WUKNDPDISA-N |
| XLogP | 8.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.95 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|