About benzhydrylidenenickel;ditert-butyl(2-ditert-butylphosphanylethyl)phosphane
benzhydrylidenenickel;ditert-butyl(2-ditert-butylphosphanylethyl)phosphane (PubChem CID 11410157) has the molecular formula C31H50NiP2
and a molecular weight of 543.38 g/mol. Its IUPAC name is benzhydrylidenenickel;ditert-butyl(2-ditert-butylphosphanylethyl)phosphane.
Molecular Properties
| Compound Name | benzhydrylidenenickel;ditert-butyl(2-ditert-butylphosphanylethyl)phosphane |
| PubChem CID | 11410157 |
| Molecular Formula | C31H50NiP2 |
| Molecular Weight | 543.38 g/mol |
| Exact Mass | 542.27 |
| IUPAC Name | benzhydrylidenenickel;ditert-butyl(2-ditert-butylphosphanylethyl)phosphane |
| SMILES | CC(C)(C)P(CCP(C(C)(C)C)C(C)(C)C)C(C)(C)C.[Ni]=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H40P2.C13H10.Ni/c1-15(2,3)19(16(4,5)6)13-14-20(17(7,8)9)18(10,11)12;1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;/h13-14H2,1-12H3;1-10H; |
| InChIKey | SSBIEUURQXRZQF-UHFFFAOYSA-N |
| XLogP | 9.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 543.38 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze benzhydrylidenenickel;ditert-butyl(2-ditert-butylphosphanylethyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzhydrylidenenickel;ditert-butyl(2-ditert-butylphosphanylethyl)phosphane?
The IUPAC name of benzhydrylidenenickel;ditert-butyl(2-ditert-butylphosphanylethyl)phosphane (CID 11410157) is benzhydrylidenenickel;ditert-butyl(2-ditert-butylphosphanylethyl)phosphane.
What is the SMILES notation for benzhydrylidenenickel;ditert-butyl(2-ditert-butylphosphanylethyl)phosphane?
The canonical SMILES for benzhydrylidenenickel;ditert-butyl(2-ditert-butylphosphanylethyl)phosphane is CC(C)(C)P(CCP(C(C)(C)C)C(C)(C)C)C(C)(C)C.[Ni]=C(c1ccccc1)c1ccccc1.
What is the InChIKey of benzhydrylidenenickel;ditert-butyl(2-ditert-butylphosphanylethyl)phosphane?
The InChIKey is SSBIEUURQXRZQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H40P2.C13H10.Ni/c1-15(2,3)19(16(4,5)6)13-14-20(17(7,8)9)18(10,11)12;1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;/h13-14H2,1-12H3;1-10H;.
What are the key properties of benzhydrylidenenickel;ditert-butyl(2-ditert-butylphosphanylethyl)phosphane?
benzhydrylidenenickel;ditert-butyl(2-ditert-butylphosphanylethyl)phosphane has a molecular weight of 543.38 g/mol, XLogP of 9.95, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzhydrylidenenickel;ditert-butyl(2-ditert-butylphosphanylethyl)phosphane is sourced from PubChem (CID 11410157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).