C30H57NNiP2 — CID 11421495
ditert-butyl(2-ditert-butylphosphanylethyl)phosphane;[2,6-di(propan-2-yl)phenyl]iminonickel (PubChem CID 11421495) has the molecular formula C30H57NNiP2 and a molecular weight of 552.43 g/mol. Its IUPAC name is ditert-butyl(2-ditert-butylphosphanylethyl)phosphane;[2,6-di(propan-2-yl)phenyl]iminonickel.
| Compound Name | ditert-butyl(2-ditert-butylphosphanylethyl)phosphane;[2,6-di(propan-2-yl)phenyl]iminonickel |
|---|---|
| PubChem CID | 11421495 |
| Molecular Formula | C30H57NNiP2 |
| Molecular Weight | 552.43 g/mol |
| Exact Mass | 551.33 |
| IUPAC Name | ditert-butyl(2-ditert-butylphosphanylethyl)phosphane;[2,6-di(propan-2-yl)phenyl]iminonickel |
| SMILES | CC(C)(C)P(CCP(C(C)(C)C)C(C)(C)C)C(C)(C)C.CC(C)c1cccc(C(C)C)c1N=[Ni] |
| InChI | InChI=1S/C18H40P2.C12H17N.Ni/c1-15(2,3)19(16(4,5)6)13-14-20(17(7,8)9)18(10,11)12;1-8(2)10-6-5-7-11(9(3)4)12(10)13;/h13-14H2,1-12H3;5-9H,1-4H3; |
| InChIKey | HSZOLQOXWFIGAO-UHFFFAOYSA-N |
| XLogP | 11.44 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.43 |
| LogP ≤ 5 | 11.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|