C10H13F4N3 — CID 114169581
6-[2-(2,2,3,3-tetrafluoropropylamino)ethyl]pyridin-3-amine (PubChem CID 114169581) has the molecular formula C10H13F4N3 and a molecular weight of 251.23 g/mol. Its IUPAC name is 6-[2-(2,2,3,3-tetrafluoropropylamino)ethyl]pyridin-3-amine.
| Compound Name | 6-[2-(2,2,3,3-tetrafluoropropylamino)ethyl]pyridin-3-amine |
|---|---|
| PubChem CID | 114169581 |
| Molecular Formula | C10H13F4N3 |
| Molecular Weight | 251.23 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 6-[2-(2,2,3,3-tetrafluoropropylamino)ethyl]pyridin-3-amine |
| SMILES | Nc1ccc(CCNCC(F)(F)C(F)F)nc1 |
| InChI | InChI=1S/C10H13F4N3/c11-9(12)10(13,14)6-16-4-3-8-2-1-7(15)5-17-8/h1-2,5,9,16H,3-4,6,15H2 |
| InChIKey | JJDJBLQVYUHVFY-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.23 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|