C19H17ClN6O — CID 11417648
5-[2-(4-chlorophenyl)-3-hydroxybenzimidazol-5-yl]-6-ethylpyrimidine-2,4-diamine (PubChem CID 11417648) has the molecular formula C19H17ClN6O and a molecular weight of 380.84 g/mol. Its IUPAC name is 5-[2-(4-chlorophenyl)-3-hydroxybenzimidazol-5-yl]-6-ethylpyrimidine-2,4-diamine.
| Compound Name | 5-[2-(4-chlorophenyl)-3-hydroxybenzimidazol-5-yl]-6-ethylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 11417648 |
| Molecular Formula | C19H17ClN6O |
| Molecular Weight | 380.84 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 5-[2-(4-chlorophenyl)-3-hydroxybenzimidazol-5-yl]-6-ethylpyrimidine-2,4-diamine |
| SMILES | CCc1nc(N)nc(N)c1-c1ccc2nc(-c3ccc(Cl)cc3)n(O)c2c1 |
| InChI | InChI=1S/C19H17ClN6O/c1-2-13-16(17(21)25-19(22)24-13)11-5-8-14-15(9-11)26(27)18(23-14)10-3-6-12(20)7-4-10/h3-9,27H,2H2,1H3,(H4,21,22,24,25) |
| InChIKey | CPQLLYKZRWYEOF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 115.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.84 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|