C19H16Cl2N6O — CID 11452730
5-[2-(3,4-dichlorophenyl)-3-hydroxybenzimidazol-5-yl]-6-ethylpyrimidine-2,4-diamine (PubChem CID 11452730) has the molecular formula C19H16Cl2N6O and a molecular weight of 415.28 g/mol. Its IUPAC name is 5-[2-(3,4-dichlorophenyl)-3-hydroxybenzimidazol-5-yl]-6-ethylpyrimidine-2,4-diamine.
| Compound Name | 5-[2-(3,4-dichlorophenyl)-3-hydroxybenzimidazol-5-yl]-6-ethylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 11452730 |
| Molecular Formula | C19H16Cl2N6O |
| Molecular Weight | 415.28 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | 5-[2-(3,4-dichlorophenyl)-3-hydroxybenzimidazol-5-yl]-6-ethylpyrimidine-2,4-diamine |
| SMILES | CCc1nc(N)nc(N)c1-c1ccc2nc(-c3ccc(Cl)c(Cl)c3)n(O)c2c1 |
| InChI | InChI=1S/C19H16Cl2N6O/c1-2-13-16(17(22)26-19(23)25-13)9-4-6-14-15(8-9)27(28)18(24-14)10-3-5-11(20)12(21)7-10/h3-8,28H,2H2,1H3,(H4,22,23,25,26) |
| InChIKey | DAPVTGBWPNUVCM-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 115.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.28 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|