About 5-[4-chloro-3-(cyclopentylamino)phenyl]-6-ethylpyrimidine-2,4-diamine;trihydrochloride
5-[4-chloro-3-(cyclopentylamino)phenyl]-6-ethylpyrimidine-2,4-diamine;trihydrochloride (PubChem CID 134124738) has the molecular formula C17H25Cl4N5
and a molecular weight of 441.23 g/mol. Its IUPAC name is 5-[4-chloro-3-(cyclopentylamino)phenyl]-6-ethylpyrimidine-2,4-diamine;trihydrochloride.
Molecular Properties
| Compound Name | 5-[4-chloro-3-(cyclopentylamino)phenyl]-6-ethylpyrimidine-2,4-diamine;trihydrochloride |
| PubChem CID | 134124738 |
| Molecular Formula | C17H25Cl4N5 |
| Molecular Weight | 441.23 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | 5-[4-chloro-3-(cyclopentylamino)phenyl]-6-ethylpyrimidine-2,4-diamine;trihydrochloride |
| SMILES | CCc1nc(N)nc(N)c1-c1ccc(Cl)c(NC2CCCC2)c1.Cl.Cl.Cl |
| InChI | InChI=1S/C17H22ClN5.3ClH/c1-2-13-15(16(19)23-17(20)22-13)10-7-8-12(18)14(9-10)21-11-5-3-4-6-11;;;/h7-9,11,21H,2-6H2,1H3,(H4,19,20,22,23);3*1H |
| InChIKey | DJJXPEHTJFSQLT-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 441.23 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[4-chloro-3-(cyclopentylamino)phenyl]-6-ethylpyrimidine-2,4-diamine;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-chloro-3-(cyclopentylamino)phenyl]-6-ethylpyrimidine-2,4-diamine;trihydrochloride?
The IUPAC name of 5-[4-chloro-3-(cyclopentylamino)phenyl]-6-ethylpyrimidine-2,4-diamine;trihydrochloride (CID 134124738) is 5-[4-chloro-3-(cyclopentylamino)phenyl]-6-ethylpyrimidine-2,4-diamine;trihydrochloride.
What is the SMILES notation for 5-[4-chloro-3-(cyclopentylamino)phenyl]-6-ethylpyrimidine-2,4-diamine;trihydrochloride?
The canonical SMILES for 5-[4-chloro-3-(cyclopentylamino)phenyl]-6-ethylpyrimidine-2,4-diamine;trihydrochloride is CCc1nc(N)nc(N)c1-c1ccc(Cl)c(NC2CCCC2)c1.Cl.Cl.Cl.
What is the InChIKey of 5-[4-chloro-3-(cyclopentylamino)phenyl]-6-ethylpyrimidine-2,4-diamine;trihydrochloride?
The InChIKey is DJJXPEHTJFSQLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22ClN5.3ClH/c1-2-13-15(16(19)23-17(20)22-13)10-7-8-12(18)14(9-10)21-11-5-3-4-6-11;;;/h7-9,11,21H,2-6H2,1H3,(H4,19,20,22,23);3*1H.
What are the key properties of 5-[4-chloro-3-(cyclopentylamino)phenyl]-6-ethylpyrimidine-2,4-diamine;trihydrochloride?
5-[4-chloro-3-(cyclopentylamino)phenyl]-6-ethylpyrimidine-2,4-diamine;trihydrochloride has a molecular weight of 441.23 g/mol, XLogP of 5.14, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-chloro-3-(cyclopentylamino)phenyl]-6-ethylpyrimidine-2,4-diamine;trihydrochloride is sourced from PubChem (CID 134124738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).