C18H26ClN7O — CID 19962304
2-[butyl-[[2-chloro-5-(2,4-diamino-6-ethylpyrimidin-5-yl)phenyl]diazenyl]amino]ethanol (PubChem CID 19962304) has the molecular formula C18H26ClN7O and a molecular weight of 391.91 g/mol. Its IUPAC name is 2-[butyl-[[2-chloro-5-(2,4-diamino-6-ethylpyrimidin-5-yl)phenyl]diazenyl]amino]ethanol.
| Compound Name | 2-[butyl-[[2-chloro-5-(2,4-diamino-6-ethylpyrimidin-5-yl)phenyl]diazenyl]amino]ethanol |
|---|---|
| PubChem CID | 19962304 |
| Molecular Formula | C18H26ClN7O |
| Molecular Weight | 391.91 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 2-[butyl-[[2-chloro-5-(2,4-diamino-6-ethylpyrimidin-5-yl)phenyl]diazenyl]amino]ethanol |
| SMILES | CCCCN(CCO)/N=N/c1cc(-c2c(N)nc(N)nc2CC)ccc1Cl |
| InChI | InChI=1S/C18H26ClN7O/c1-3-5-8-26(9-10-27)25-24-15-11-12(6-7-13(15)19)16-14(4-2)22-18(21)23-17(16)20/h6-7,11,27H,3-5,8-10H2,1-2H3,(H4,20,21,22,23)/b25-24+ |
| InChIKey | QEGXFNSUFAIZPT-OCOZRVBESA-N |
| XLogP | 3.62 |
| TPSA | 126.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.91 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|