C17H25N — CID 114190634
5,5-dimethyl-1-(2,4,6-trimethylphenyl)hex-3-yn-1-amine (PubChem CID 114190634) has the molecular formula C17H25N and a molecular weight of 243.39 g/mol. Its IUPAC name is 5,5-dimethyl-1-(2,4,6-trimethylphenyl)hex-3-yn-1-amine.
| Compound Name | 5,5-dimethyl-1-(2,4,6-trimethylphenyl)hex-3-yn-1-amine |
|---|---|
| PubChem CID | 114190634 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | 5,5-dimethyl-1-(2,4,6-trimethylphenyl)hex-3-yn-1-amine |
| SMILES | Cc1cc(C)c(C(N)CC#CC(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C17H25N/c1-12-10-13(2)16(14(3)11-12)15(18)8-7-9-17(4,5)6/h10-11,15H,8,18H2,1-6H3 |
| InChIKey | VNFAMLTWIMDBHN-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|