C14H21F3N2 — CID 114211448
[5,5-dimethyl-1-(3,4,5-trifluorophenyl)hexyl]hydrazine (PubChem CID 114211448) has the molecular formula C14H21F3N2 and a molecular weight of 274.33 g/mol. Its IUPAC name is [5,5-dimethyl-1-(3,4,5-trifluorophenyl)hexyl]hydrazine.
| Compound Name | [5,5-dimethyl-1-(3,4,5-trifluorophenyl)hexyl]hydrazine |
|---|---|
| PubChem CID | 114211448 |
| Molecular Formula | C14H21F3N2 |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | [5,5-dimethyl-1-(3,4,5-trifluorophenyl)hexyl]hydrazine |
| SMILES | CC(C)(C)CCCC(NN)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C14H21F3N2/c1-14(2,3)6-4-5-12(19-18)9-7-10(15)13(17)11(16)8-9/h7-8,12,19H,4-6,18H2,1-3H3 |
| InChIKey | YZTQZZJRKJWHGO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|